C20H26N2O — CID 21141188
(1S,12R,19R)-12-ethyl-5-methoxy-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,8-tetraene (PubChem CID 21141188) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is (1S,12R,19R)-12-ethyl-5-methoxy-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,8-tetraene.
| Compound Name | (1S,12R,19R)-12-ethyl-5-methoxy-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,8-tetraene |
|---|---|
| PubChem CID | 21141188 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | (1S,12R,19R)-12-ethyl-5-methoxy-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,8-tetraene |
| SMILES | CC[C@@]12CCCN3CC[C@@]4(C(=Nc5cc(OC)ccc54)CC1)[C@H]32 |
| InChI | InChI=1S/C20H26N2O/c1-3-19-8-4-11-22-12-10-20(18(19)22)15-6-5-14(23-2)13-16(15)21-17(20)7-9-19/h5-6,13,18H,3-4,7-12H2,1-2H3/t18-,19-,20-/m1/s1 |
| InChIKey | GAJHLAVQCBWYPR-VAMGGRTRSA-N |
| XLogP | 4.08 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |