C12H11ClN6O2S — CID 21141547
5-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-hydroxy-1-methylimidazol-4-amine oxide (PubChem CID 21141547) has the molecular formula C12H11ClN6O2S and a molecular weight of 338.78 g/mol. Its IUPAC name is 5-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-hydroxy-1-methylimidazol-4-amine oxide.
| Compound Name | 5-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-hydroxy-1-methylimidazol-4-amine oxide |
|---|---|
| PubChem CID | 21141547 |
| Molecular Formula | C12H11ClN6O2S |
| Molecular Weight | 338.78 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 5-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-hydroxy-1-methylimidazol-4-amine oxide |
| SMILES | Cn1cnc([NH+]([O-])O)c1Sc1n[nH]c(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C12H11ClN6O2S/c1-18-6-14-10(19(20)21)11(18)22-12-15-9(16-17-12)7-2-4-8(13)5-3-7/h2-6,19-20H,1H3,(H,15,16,17) |
| InChIKey | FMANSVGXHXHQFG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 107.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.78 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|