C12H10ClN6O2S- — CID 21141548
N-[5-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-1-methylimidazol-4-yl]-N-oxidohydroxylamine (PubChem CID 21141548) has the molecular formula C12H10ClN6O2S- and a molecular weight of 337.77 g/mol. Its IUPAC name is N-[5-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-1-methylimidazol-4-yl]-N-oxidohydroxylamine.
| Compound Name | N-[5-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-1-methylimidazol-4-yl]-N-oxidohydroxylamine |
|---|---|
| PubChem CID | 21141548 |
| Molecular Formula | C12H10ClN6O2S- |
| Molecular Weight | 337.77 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | N-[5-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-1-methylimidazol-4-yl]-N-oxidohydroxylamine |
| SMILES | Cn1cnc(N([O-])O)c1Sc1n[nH]c(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C12H10ClN6O2S/c1-18-6-14-10(19(20)21)11(18)22-12-15-9(16-17-12)7-2-4-8(13)5-3-7/h2-6,20H,1H3,(H,15,16,17)/q-1 |
| InChIKey | XDVANJJRYULJPO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.77 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|