C31H33N4O6- — CID 21141856
3-N,5-N-bis(2-ethoxyphenyl)-4-[3-[hydroxy(oxido)amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxamide (PubChem CID 21141856) has the molecular formula C31H33N4O6- and a molecular weight of 557.63 g/mol. Its IUPAC name is 3-N,5-N-bis(2-ethoxyphenyl)-4-[3-[hydroxy(oxido)amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxamide.
| Compound Name | 3-N,5-N-bis(2-ethoxyphenyl)-4-[3-[hydroxy(oxido)amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 21141856 |
| Molecular Formula | C31H33N4O6- |
| Molecular Weight | 557.63 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | 3-N,5-N-bis(2-ethoxyphenyl)-4-[3-[hydroxy(oxido)amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxamide |
| SMILES | CCOc1ccccc1NC(=O)C1=C(C)NC(C)=C(C(=O)Nc2ccccc2OCC)C1c1cccc(N([O-])O)c1 |
| InChI | InChI=1S/C31H33N4O6/c1-5-40-25-16-9-7-14-23(25)33-30(36)27-19(3)32-20(4)28(29(27)21-12-11-13-22(18-21)35(38)39)31(37)34-24-15-8-10-17-26(24)41-6-2/h7-18,29,32,38H,5-6H2,1-4H3,(H,33,36)(H,34,37)/q-1 |
| InChIKey | RXKXRAYTCKDIQU-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.63 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|