C15H25N7O5 — CID 21142120
N-hydroxy-3-[2-[6-[2-[hydroxy(oxido)azaniumyl]imidazol-1-yl]hexanoylamino]ethyl]-2-methylimidazol-4-amine oxide (PubChem CID 21142120) has the molecular formula C15H25N7O5 and a molecular weight of 383.41 g/mol. Its IUPAC name is N-hydroxy-3-[2-[6-[2-[hydroxy(oxido)azaniumyl]imidazol-1-yl]hexanoylamino]ethyl]-2-methylimidazol-4-amine oxide.
| Compound Name | N-hydroxy-3-[2-[6-[2-[hydroxy(oxido)azaniumyl]imidazol-1-yl]hexanoylamino]ethyl]-2-methylimidazol-4-amine oxide |
|---|---|
| PubChem CID | 21142120 |
| Molecular Formula | C15H25N7O5 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | N-hydroxy-3-[2-[6-[2-[hydroxy(oxido)azaniumyl]imidazol-1-yl]hexanoylamino]ethyl]-2-methylimidazol-4-amine oxide |
| SMILES | Cc1ncc([NH+]([O-])O)n1CCNC(=O)CCCCCn1ccnc1[NH+]([O-])O |
| InChI | InChI=1S/C15H25N7O5/c1-12-18-11-14(21(24)25)20(12)10-7-16-13(23)5-3-2-4-8-19-9-6-17-15(19)22(26)27/h6,9,11,21-22,24,26H,2-5,7-8,10H2,1H3,(H,16,23) |
| InChIKey | IMJWCUUPYXPJLL-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 160.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|