C23H15Cl2N3O7 — CID 21142282
3,5-dichloro-4-[[2,4-dioxo-3-(3-oxo-1H-2-benzofuran-1-yl)-4-pyridin-4-ylbutanoyl]amino]-N-hydroxybenzeneamine oxide (PubChem CID 21142282) has the molecular formula C23H15Cl2N3O7 and a molecular weight of 516.29 g/mol. Its IUPAC name is 3,5-dichloro-4-[[2,4-dioxo-3-(3-oxo-1H-2-benzofuran-1-yl)-4-pyridin-4-ylbutanoyl]amino]-N-hydroxybenzeneamine oxide.
| Compound Name | 3,5-dichloro-4-[[2,4-dioxo-3-(3-oxo-1H-2-benzofuran-1-yl)-4-pyridin-4-ylbutanoyl]amino]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 21142282 |
| Molecular Formula | C23H15Cl2N3O7 |
| Molecular Weight | 516.29 g/mol |
| Exact Mass | 515.03 |
| IUPAC Name | 3,5-dichloro-4-[[2,4-dioxo-3-(3-oxo-1H-2-benzofuran-1-yl)-4-pyridin-4-ylbutanoyl]amino]-N-hydroxybenzeneamine oxide |
| SMILES | O=C(Nc1c(Cl)cc([NH+]([O-])O)cc1Cl)C(=O)C(C(=O)c1ccncc1)C1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C23H15Cl2N3O7/c24-15-9-12(28(33)34)10-16(25)18(15)27-22(31)20(30)17(19(29)11-5-7-26-8-6-11)21-13-3-1-2-4-14(13)23(32)35-21/h1-10,17,21,28,33H,(H,27,31) |
| InChIKey | JVZQGJNDHZNAHQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 150.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|