C12H18N4O7 — CID 21142504
4-[(1,4-diethoxy-1,4-dioxobutan-2-yl)carbamoyl]-N-hydroxy-1H-imidazol-5-amine oxide (PubChem CID 21142504) has the molecular formula C12H18N4O7 and a molecular weight of 330.30 g/mol. Its IUPAC name is 4-[(1,4-diethoxy-1,4-dioxobutan-2-yl)carbamoyl]-N-hydroxy-1H-imidazol-5-amine oxide.
| Compound Name | 4-[(1,4-diethoxy-1,4-dioxobutan-2-yl)carbamoyl]-N-hydroxy-1H-imidazol-5-amine oxide |
|---|---|
| PubChem CID | 21142504 |
| Molecular Formula | C12H18N4O7 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 4-[(1,4-diethoxy-1,4-dioxobutan-2-yl)carbamoyl]-N-hydroxy-1H-imidazol-5-amine oxide |
| SMILES | CCOC(=O)CC(NC(=O)c1nc[nH]c1[NH+]([O-])O)C(=O)OCC |
| InChI | InChI=1S/C12H18N4O7/c1-3-22-8(17)5-7(12(19)23-4-2)15-11(18)9-10(16(20)21)14-6-13-9/h6-7,16,20H,3-5H2,1-2H3,(H,13,14)(H,15,18) |
| InChIKey | UUWBEHGTAXXJQO-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 158.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|