C15H12ClNO2S2 — CID 21142725
(2Z)-6-acetyl-2-[(2-chlorophenyl)methylidene]-5-methyl-7aH-[1,3]thiazolo[2,3-b][1,3]thiazol-3-one (PubChem CID 21142725) has the molecular formula C15H12ClNO2S2 and a molecular weight of 337.85 g/mol. Its IUPAC name is (2Z)-6-acetyl-2-[(2-chlorophenyl)methylidene]-5-methyl-7aH-[1,3]thiazolo[2,3-b][1,3]thiazol-3-one.
| Compound Name | (2Z)-6-acetyl-2-[(2-chlorophenyl)methylidene]-5-methyl-7aH-[1,3]thiazolo[2,3-b][1,3]thiazol-3-one |
|---|---|
| PubChem CID | 21142725 |
| Molecular Formula | C15H12ClNO2S2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | (2Z)-6-acetyl-2-[(2-chlorophenyl)methylidene]-5-methyl-7aH-[1,3]thiazolo[2,3-b][1,3]thiazol-3-one |
| SMILES | CC(=O)C1=C(C)N2C(=O)/C(=C/c3ccccc3Cl)SC2S1 |
| InChI | InChI=1S/C15H12ClNO2S2/c1-8-13(9(2)18)21-15-17(8)14(19)12(20-15)7-10-5-3-4-6-11(10)16/h3-7,15H,1-2H3/b12-7- |
| InChIKey | XQCSDEZNHROWRZ-GHXNOFRVSA-N |
| XLogP | 4.11 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|