C12H22Cl3N3O2 — CID 21142956
3,4,4-trichloro-1,1-bis(diethylamino)-N-hydroxybuta-1,3-dien-2-amine oxide (PubChem CID 21142956) has the molecular formula C12H22Cl3N3O2 and a molecular weight of 346.69 g/mol. Its IUPAC name is 3,4,4-trichloro-1,1-bis(diethylamino)-N-hydroxybuta-1,3-dien-2-amine oxide.
| Compound Name | 3,4,4-trichloro-1,1-bis(diethylamino)-N-hydroxybuta-1,3-dien-2-amine oxide |
|---|---|
| PubChem CID | 21142956 |
| Molecular Formula | C12H22Cl3N3O2 |
| Molecular Weight | 346.69 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 3,4,4-trichloro-1,1-bis(diethylamino)-N-hydroxybuta-1,3-dien-2-amine oxide |
| SMILES | CCN(CC)C(=C(C(Cl)=C(Cl)Cl)[NH+]([O-])O)N(CC)CC |
| InChI | InChI=1S/C12H22Cl3N3O2/c1-5-16(6-2)12(17(7-3)8-4)10(18(19)20)9(13)11(14)15/h18-19H,5-8H2,1-4H3 |
| InChIKey | FNCKKXUDNKJQEE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 54.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.69 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|