C12H21Cl3N3O2- — CID 21142957
N-oxido-N-[3,4,4-trichloro-1,1-bis(diethylamino)buta-1,3-dien-2-yl]hydroxylamine (PubChem CID 21142957) has the molecular formula C12H21Cl3N3O2- and a molecular weight of 345.68 g/mol. Its IUPAC name is N-oxido-N-[3,4,4-trichloro-1,1-bis(diethylamino)buta-1,3-dien-2-yl]hydroxylamine.
| Compound Name | N-oxido-N-[3,4,4-trichloro-1,1-bis(diethylamino)buta-1,3-dien-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 21142957 |
| Molecular Formula | C12H21Cl3N3O2- |
| Molecular Weight | 345.68 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | N-oxido-N-[3,4,4-trichloro-1,1-bis(diethylamino)buta-1,3-dien-2-yl]hydroxylamine |
| SMILES | CCN(CC)C(=C(C(Cl)=C(Cl)Cl)N([O-])O)N(CC)CC |
| InChI | InChI=1S/C12H21Cl3N3O2/c1-5-16(6-2)12(17(7-3)8-4)10(18(19)20)9(13)11(14)15/h19H,5-8H2,1-4H3/q-1 |
| InChIKey | RKSZGRJDZMDLII-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.68 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|