About 4-[5-(1-adamantyl)-1,3,4-oxadiazol-2-yl]-N-hydroxybenzeneamine oxide
4-[5-(1-adamantyl)-1,3,4-oxadiazol-2-yl]-N-hydroxybenzeneamine oxide (PubChem CID 21142991) has the molecular formula C18H21N3O3
and a molecular weight of 327.38 g/mol. Its IUPAC name is 4-[5-(1-adamantyl)-1,3,4-oxadiazol-2-yl]-N-hydroxybenzeneamine oxide.
Molecular Properties
| Compound Name | 4-[5-(1-adamantyl)-1,3,4-oxadiazol-2-yl]-N-hydroxybenzeneamine oxide |
| PubChem CID | 21142991 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 4-[5-(1-adamantyl)-1,3,4-oxadiazol-2-yl]-N-hydroxybenzeneamine oxide |
| SMILES | [O-][NH+](O)c1ccc(-c2nnc(C34CC5CC(CC(C5)C3)C4)o2)cc1 |
| InChI | InChI=1S/C18H21N3O3/c22-21(23)15-3-1-14(2-4-15)16-19-20-17(24-16)18-8-11-5-12(9-18)7-13(6-11)10-18/h1-4,11-13,21-22H,5-10H2 |
| InChIKey | GTXWLBWVYJJWPI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 86.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-(1-adamantyl)-1,3,4-oxadiazol-2-yl]-N-hydroxybenzeneamine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(1-adamantyl)-1,3,4-oxadiazol-2-yl]-N-hydroxybenzeneamine oxide?
The IUPAC name of 4-[5-(1-adamantyl)-1,3,4-oxadiazol-2-yl]-N-hydroxybenzeneamine oxide (CID 21142991) is 4-[5-(1-adamantyl)-1,3,4-oxadiazol-2-yl]-N-hydroxybenzeneamine oxide.
What is the SMILES notation for 4-[5-(1-adamantyl)-1,3,4-oxadiazol-2-yl]-N-hydroxybenzeneamine oxide?
The canonical SMILES for 4-[5-(1-adamantyl)-1,3,4-oxadiazol-2-yl]-N-hydroxybenzeneamine oxide is [O-][NH+](O)c1ccc(-c2nnc(C34CC5CC(CC(C5)C3)C4)o2)cc1.
What is the InChIKey of 4-[5-(1-adamantyl)-1,3,4-oxadiazol-2-yl]-N-hydroxybenzeneamine oxide?
The InChIKey is GTXWLBWVYJJWPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O3/c22-21(23)15-3-1-14(2-4-15)16-19-20-17(24-16)18-8-11-5-12(9-18)7-13(6-11)10-18/h1-4,11-13,21-22H,5-10H2.
What are the key properties of 4-[5-(1-adamantyl)-1,3,4-oxadiazol-2-yl]-N-hydroxybenzeneamine oxide?
4-[5-(1-adamantyl)-1,3,4-oxadiazol-2-yl]-N-hydroxybenzeneamine oxide has a molecular weight of 327.38 g/mol, XLogP of 2.61, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(1-adamantyl)-1,3,4-oxadiazol-2-yl]-N-hydroxybenzeneamine oxide is sourced from PubChem (CID 21142991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).