C29H32N3O5- — CID 21143070
9-tert-butyl-4-[4-[hydroxy(oxido)amino]-2-methoxyphenyl]-4,20-diazapentacyclo[11.7.0.02,6.07,12.014,19]icosa-1(13),14,16,18-tetraene-3,5-dione (PubChem CID 21143070) has the molecular formula C29H32N3O5- and a molecular weight of 502.59 g/mol. Its IUPAC name is 9-tert-butyl-4-[4-[hydroxy(oxido)amino]-2-methoxyphenyl]-4,20-diazapentacyclo[11.7.0.02,6.07,12.014,19]icosa-1(13),14,16,18-tetraene-3,5-dione.
| Compound Name | 9-tert-butyl-4-[4-[hydroxy(oxido)amino]-2-methoxyphenyl]-4,20-diazapentacyclo[11.7.0.02,6.07,12.014,19]icosa-1(13),14,16,18-tetraene-3,5-dione |
|---|---|
| PubChem CID | 21143070 |
| Molecular Formula | C29H32N3O5- |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | 9-tert-butyl-4-[4-[hydroxy(oxido)amino]-2-methoxyphenyl]-4,20-diazapentacyclo[11.7.0.02,6.07,12.014,19]icosa-1(13),14,16,18-tetraene-3,5-dione |
| SMILES | COc1cc(N([O-])O)ccc1N1C(=O)C2c3[nH]c4ccccc4c3C3CCC(C(C)(C)C)CC3C2C1=O |
| InChI | InChI=1S/C29H32N3O5/c1-29(2,3)15-9-11-17-19(13-15)24-25(26-23(17)18-7-5-6-8-20(18)30-26)28(34)31(27(24)33)21-12-10-16(32(35)36)14-22(21)37-4/h5-8,10,12,14-15,17,19,24-25,30,35H,9,11,13H2,1-4H3/q-1 |
| InChIKey | JLEPSWMAUKVEAB-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|