About 9-azidophenalen-1-one
9-azidophenalen-1-one (PubChem CID 21143079) has the molecular formula C13H7N3O
and a molecular weight of 221.22 g/mol. Its IUPAC name is 9-azidophenalen-1-one.
Molecular Properties
| Compound Name | 9-azidophenalen-1-one |
| PubChem CID | 21143079 |
| Molecular Formula | C13H7N3O |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 9-azidophenalen-1-one |
| SMILES | [N-]=[N+]=Nc1ccc2cccc3c2c1C(=O)C=C3 |
| InChI | InChI=1S/C13H7N3O/c14-16-15-10-6-4-8-2-1-3-9-5-7-11(17)13(10)12(8)9/h1-7H |
| InChIKey | BDTZBEGJZRWXNC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 9-azidophenalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-azidophenalen-1-one?
The IUPAC name of 9-azidophenalen-1-one (CID 21143079) is 9-azidophenalen-1-one.
What is the SMILES notation for 9-azidophenalen-1-one?
The canonical SMILES for 9-azidophenalen-1-one is [N-]=[N+]=Nc1ccc2cccc3c2c1C(=O)C=C3.
What is the InChIKey of 9-azidophenalen-1-one?
The InChIKey is BDTZBEGJZRWXNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7N3O/c14-16-15-10-6-4-8-2-1-3-9-5-7-11(17)13(10)12(8)9/h1-7H.
What are the key properties of 9-azidophenalen-1-one?
9-azidophenalen-1-one has a molecular weight of 221.22 g/mol, XLogP of 3.99, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-azidophenalen-1-one is sourced from PubChem (CID 21143079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).