C25H20N3O6- — CID 21143465
2-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-5-[hydroxy(oxido)amino]benzo[de]isoquinoline-1,3-dione (PubChem CID 21143465) has the molecular formula C25H20N3O6- and a molecular weight of 458.45 g/mol. Its IUPAC name is 2-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-5-[hydroxy(oxido)amino]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-5-[hydroxy(oxido)amino]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 21143465 |
| Molecular Formula | C25H20N3O6- |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 2-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-5-[hydroxy(oxido)amino]benzo[de]isoquinoline-1,3-dione |
| SMILES | CCC1(c2ccc(N3C(=O)c4cccc5cc(N([O-])O)cc(c45)C3=O)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C25H20N3O6/c1-2-25(11-10-20(29)26-24(25)32)15-6-8-16(9-7-15)27-22(30)18-5-3-4-14-12-17(28(33)34)13-19(21(14)18)23(27)31/h3-9,12-13,33H,2,10-11H2,1H3,(H,26,29,32)/q-1 |
| InChIKey | LFYWZBODASIOOE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|