C18H20HgN5O6S+ — CID 21144144
1,3-dimethyl-7H-purine-2,6-dione;[2-methoxy-3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propyl]mercury(1+) (PubChem CID 21144144) has the molecular formula C18H20HgN5O6S+ and a molecular weight of 635.04 g/mol. Its IUPAC name is 1,3-dimethyl-7H-purine-2,6-dione;[2-methoxy-3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propyl]mercury(1+).
| Compound Name | 1,3-dimethyl-7H-purine-2,6-dione;[2-methoxy-3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propyl]mercury(1+) |
|---|---|
| PubChem CID | 21144144 |
| Molecular Formula | C18H20HgN5O6S+ |
| Molecular Weight | 635.04 g/mol |
| Exact Mass | 636.08 |
| IUPAC Name | 1,3-dimethyl-7H-purine-2,6-dione;[2-methoxy-3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propyl]mercury(1+) |
| SMILES | COC(C[Hg+])CN1C(=O)c2ccccc2S1(=O)=O.Cn1c(=O)c2[nH]cnc2n(C)c1=O |
| InChI | InChI=1S/C11H12NO4S.C7H8N4O2.Hg/c1-8(16-2)7-12-11(13)9-5-3-4-6-10(9)17(12,14)15;1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;/h3-6,8H,1,7H2,2H3;3H,1-2H3,(H,8,9);/q;;+1 |
| InChIKey | IJHYMLNZGFHXEQ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 136.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.04 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|