About 5-[bis(2-chloroethyl)aminomethyl]-6-methyl-1H-pyrimidine-2,4-dione;hydrochloride
5-[bis(2-chloroethyl)aminomethyl]-6-methyl-1H-pyrimidine-2,4-dione;hydrochloride (PubChem CID 21144240) has the molecular formula C10H16Cl3N3O2
and a molecular weight of 316.62 g/mol. Its IUPAC name is 5-[bis(2-chloroethyl)aminomethyl]-6-methyl-1H-pyrimidine-2,4-dione;hydrochloride.
Molecular Properties
| Compound Name | 5-[bis(2-chloroethyl)aminomethyl]-6-methyl-1H-pyrimidine-2,4-dione;hydrochloride |
| PubChem CID | 21144240 |
| Molecular Formula | C10H16Cl3N3O2 |
| Molecular Weight | 316.62 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 5-[bis(2-chloroethyl)aminomethyl]-6-methyl-1H-pyrimidine-2,4-dione;hydrochloride |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1CN(CCCl)CCCl.Cl |
| InChI | InChI=1S/C10H15Cl2N3O2.ClH/c1-7-8(9(16)14-10(17)13-7)6-15(4-2-11)5-3-12;/h2-6H2,1H3,(H2,13,14,16,17);1H |
| InChIKey | MKGLLNZSVDWDND-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.62 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-[bis(2-chloroethyl)aminomethyl]-6-methyl-1H-pyrimidine-2,4-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[bis(2-chloroethyl)aminomethyl]-6-methyl-1H-pyrimidine-2,4-dione;hydrochloride?
The IUPAC name of 5-[bis(2-chloroethyl)aminomethyl]-6-methyl-1H-pyrimidine-2,4-dione;hydrochloride (CID 21144240) is 5-[bis(2-chloroethyl)aminomethyl]-6-methyl-1H-pyrimidine-2,4-dione;hydrochloride.
What is the SMILES notation for 5-[bis(2-chloroethyl)aminomethyl]-6-methyl-1H-pyrimidine-2,4-dione;hydrochloride?
The canonical SMILES for 5-[bis(2-chloroethyl)aminomethyl]-6-methyl-1H-pyrimidine-2,4-dione;hydrochloride is Cc1[nH]c(=O)[nH]c(=O)c1CN(CCCl)CCCl.Cl.
What is the InChIKey of 5-[bis(2-chloroethyl)aminomethyl]-6-methyl-1H-pyrimidine-2,4-dione;hydrochloride?
The InChIKey is MKGLLNZSVDWDND-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15Cl2N3O2.ClH/c1-7-8(9(16)14-10(17)13-7)6-15(4-2-11)5-3-12;/h2-6H2,1H3,(H2,13,14,16,17);1H.
What are the key properties of 5-[bis(2-chloroethyl)aminomethyl]-6-methyl-1H-pyrimidine-2,4-dione;hydrochloride?
5-[bis(2-chloroethyl)aminomethyl]-6-methyl-1H-pyrimidine-2,4-dione;hydrochloride has a molecular weight of 316.62 g/mol, XLogP of 1.07, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[bis(2-chloroethyl)aminomethyl]-6-methyl-1H-pyrimidine-2,4-dione;hydrochloride is sourced from PubChem (CID 21144240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).