About N'-acetylpiperidine-2-carbohydrazide;hydrochloride
N'-acetylpiperidine-2-carbohydrazide;hydrochloride (PubChem CID 21144425) has the molecular formula C8H16ClN3O2
and a molecular weight of 221.69 g/mol. Its IUPAC name is N'-acetylpiperidine-2-carbohydrazide;hydrochloride.
Molecular Properties
| Compound Name | N'-acetylpiperidine-2-carbohydrazide;hydrochloride |
| PubChem CID | 21144425 |
| Molecular Formula | C8H16ClN3O2 |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | N'-acetylpiperidine-2-carbohydrazide;hydrochloride |
| SMILES | CC(=O)NNC(=O)C1CCCCN1.Cl |
| InChI | InChI=1S/C8H15N3O2.ClH/c1-6(12)10-11-8(13)7-4-2-3-5-9-7;/h7,9H,2-5H2,1H3,(H,10,12)(H,11,13);1H |
| InChIKey | GXJAGECJDOGHJW-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-acetylpiperidine-2-carbohydrazide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-acetylpiperidine-2-carbohydrazide;hydrochloride?
The IUPAC name of N'-acetylpiperidine-2-carbohydrazide;hydrochloride (CID 21144425) is N'-acetylpiperidine-2-carbohydrazide;hydrochloride.
What is the SMILES notation for N'-acetylpiperidine-2-carbohydrazide;hydrochloride?
The canonical SMILES for N'-acetylpiperidine-2-carbohydrazide;hydrochloride is CC(=O)NNC(=O)C1CCCCN1.Cl.
What is the InChIKey of N'-acetylpiperidine-2-carbohydrazide;hydrochloride?
The InChIKey is GXJAGECJDOGHJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O2.ClH/c1-6(12)10-11-8(13)7-4-2-3-5-9-7;/h7,9H,2-5H2,1H3,(H,10,12)(H,11,13);1H.
What are the key properties of N'-acetylpiperidine-2-carbohydrazide;hydrochloride?
N'-acetylpiperidine-2-carbohydrazide;hydrochloride has a molecular weight of 221.69 g/mol, XLogP of -0.28, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-acetylpiperidine-2-carbohydrazide;hydrochloride is sourced from PubChem (CID 21144425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).