C15H18ClNO4S — CID 21144736
[4-(2,6-dimethylthiopyran-4-ylidene)cyclohexa-2,5-dien-1-ylidene]-dimethylazanium perchlorate (PubChem CID 21144736) has the molecular formula C15H18ClNO4S and a molecular weight of 343.83 g/mol. Its IUPAC name is [4-(2,6-dimethylthiopyran-4-ylidene)cyclohexa-2,5-dien-1-ylidene]-dimethylazanium perchlorate.
| Compound Name | [4-(2,6-dimethylthiopyran-4-ylidene)cyclohexa-2,5-dien-1-ylidene]-dimethylazanium perchlorate |
|---|---|
| PubChem CID | 21144736 |
| Molecular Formula | C15H18ClNO4S |
| Molecular Weight | 343.83 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | [4-(2,6-dimethylthiopyran-4-ylidene)cyclohexa-2,5-dien-1-ylidene]-dimethylazanium perchlorate |
| SMILES | CC1=CC(=C2C=CC(=[N+](C)C)C=C2)C=C(C)S1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C15H18NS.ClHO4/c1-11-9-14(10-12(2)17-11)13-5-7-15(8-6-13)16(3)4;2-1(3,4)5/h5-10H,1-4H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | BMHAIPGYXFPWBU-UHFFFAOYSA-M |
| XLogP | -1.08 |
| TPSA | 95.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.83 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|