C15H26ClN3O3 — CID 21144799
1-cyclohexyl-5-[(dimethylamino)methyl]-3,5-dimethyl-1,3-diazinane-2,4,6-trione;hydrochloride (PubChem CID 21144799) has the molecular formula C15H26ClN3O3 and a molecular weight of 331.84 g/mol. Its IUPAC name is 1-cyclohexyl-5-[(dimethylamino)methyl]-3,5-dimethyl-1,3-diazinane-2,4,6-trione;hydrochloride.
| Compound Name | 1-cyclohexyl-5-[(dimethylamino)methyl]-3,5-dimethyl-1,3-diazinane-2,4,6-trione;hydrochloride |
|---|---|
| PubChem CID | 21144799 |
| Molecular Formula | C15H26ClN3O3 |
| Molecular Weight | 331.84 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-cyclohexyl-5-[(dimethylamino)methyl]-3,5-dimethyl-1,3-diazinane-2,4,6-trione;hydrochloride |
| SMILES | CN(C)CC1(C)C(=O)N(C)C(=O)N(C2CCCCC2)C1=O.Cl |
| InChI | InChI=1S/C15H25N3O3.ClH/c1-15(10-16(2)3)12(19)17(4)14(21)18(13(15)20)11-8-6-5-7-9-11;/h11H,5-10H2,1-4H3;1H |
| InChIKey | AGPGSUZFUKTFOM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.84 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|