About sodium N-(5-bromo-2-pyridinyl)nitrous amide
sodium N-(5-bromo-2-pyridinyl)nitrous amide (PubChem CID 21144863) has the molecular formula C5H4BrN3NaO+
and a molecular weight of 225.00 g/mol. Its IUPAC name is sodium N-(5-bromo-2-pyridinyl)nitrous amide.
Molecular Properties
| Compound Name | sodium N-(5-bromo-2-pyridinyl)nitrous amide |
| PubChem CID | 21144863 |
| Molecular Formula | C5H4BrN3NaO+ |
| Molecular Weight | 225.00 g/mol |
| Exact Mass | 223.94 |
| IUPAC Name | sodium N-(5-bromo-2-pyridinyl)nitrous amide |
| SMILES | O=NNc1ccc(Br)cn1.[Na+] |
| InChI | InChI=1S/C5H4BrN3O.Na/c6-4-1-2-5(7-3-4)8-9-10;/h1-3H,(H,7,8,10);/q;+1 |
| InChIKey | SIRKMQSTJMJKRM-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.00 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium N-(5-bromo-2-pyridinyl)nitrous amide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium N-(5-bromo-2-pyridinyl)nitrous amide?
The IUPAC name of sodium N-(5-bromo-2-pyridinyl)nitrous amide (CID 21144863) is sodium N-(5-bromo-2-pyridinyl)nitrous amide.
What is the SMILES notation for sodium N-(5-bromo-2-pyridinyl)nitrous amide?
The canonical SMILES for sodium N-(5-bromo-2-pyridinyl)nitrous amide is O=NNc1ccc(Br)cn1.[Na+].
What is the InChIKey of sodium N-(5-bromo-2-pyridinyl)nitrous amide?
The InChIKey is SIRKMQSTJMJKRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4BrN3O.Na/c6-4-1-2-5(7-3-4)8-9-10;/h1-3H,(H,7,8,10);/q;+1.
What are the key properties of sodium N-(5-bromo-2-pyridinyl)nitrous amide?
sodium N-(5-bromo-2-pyridinyl)nitrous amide has a molecular weight of 225.00 g/mol, XLogP of -1.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium N-(5-bromo-2-pyridinyl)nitrous amide is sourced from PubChem (CID 21144863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).