About (2R,3S)-2-hydroxy-2,3-dimethylbutanedioate
(2R,3S)-2-hydroxy-2,3-dimethylbutanedioate (PubChem CID 21145051) has the molecular formula C6H8O5-2
and a molecular weight of 160.12 g/mol. Its IUPAC name is (2R,3S)-2-hydroxy-2,3-dimethylbutanedioate.
Molecular Properties
| Compound Name | (2R,3S)-2-hydroxy-2,3-dimethylbutanedioate |
| PubChem CID | 21145051 |
| Molecular Formula | C6H8O5-2 |
| Molecular Weight | 160.12 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | (2R,3S)-2-hydroxy-2,3-dimethylbutanedioate |
| SMILES | C[C@H](C(=O)[O-])[C@@](C)(O)C(=O)[O-] |
| InChI | InChI=1S/C6H10O5/c1-3(4(7)8)6(2,11)5(9)10/h3,11H,1-2H3,(H,7,8)(H,9,10)/p-2/t3-,6-/m1/s1 |
| InChIKey | WTIIULQJLZEHGZ-AWFVSMACSA-L |
| XLogP | -3.13 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.12 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R,3S)-2-hydroxy-2,3-dimethylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-2-hydroxy-2,3-dimethylbutanedioate?
The IUPAC name of (2R,3S)-2-hydroxy-2,3-dimethylbutanedioate (CID 21145051) is (2R,3S)-2-hydroxy-2,3-dimethylbutanedioate.
What is the SMILES notation for (2R,3S)-2-hydroxy-2,3-dimethylbutanedioate?
The canonical SMILES for (2R,3S)-2-hydroxy-2,3-dimethylbutanedioate is C[C@H](C(=O)[O-])[C@@](C)(O)C(=O)[O-].
What is the InChIKey of (2R,3S)-2-hydroxy-2,3-dimethylbutanedioate?
The InChIKey is WTIIULQJLZEHGZ-AWFVSMACSA-L. The full InChI is InChI=1S/C6H10O5/c1-3(4(7)8)6(2,11)5(9)10/h3,11H,1-2H3,(H,7,8)(H,9,10)/p-2/t3-,6-/m1/s1.
What are the key properties of (2R,3S)-2-hydroxy-2,3-dimethylbutanedioate?
(2R,3S)-2-hydroxy-2,3-dimethylbutanedioate has a molecular weight of 160.12 g/mol, XLogP of -3.13, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-2-hydroxy-2,3-dimethylbutanedioate is sourced from PubChem (CID 21145051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).