C4H13N3O7P2 — CID 21145094
[[(E)-N'-[1-[hydroxy(methoxy)phosphoryl]oxyethyl]carbamimidoyl]amino]phosphonic acid (PubChem CID 21145094) has the molecular formula C4H13N3O7P2 and a molecular weight of 277.11 g/mol. Its IUPAC name is [[(E)-N'-[1-[hydroxy(methoxy)phosphoryl]oxyethyl]carbamimidoyl]amino]phosphonic acid.
| Compound Name | [[(E)-N'-[1-[hydroxy(methoxy)phosphoryl]oxyethyl]carbamimidoyl]amino]phosphonic acid |
|---|---|
| PubChem CID | 21145094 |
| Molecular Formula | C4H13N3O7P2 |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | [[(E)-N'-[1-[hydroxy(methoxy)phosphoryl]oxyethyl]carbamimidoyl]amino]phosphonic acid |
| SMILES | COP(=O)(O)OC(C)/N=C(\N)NP(=O)(O)O |
| InChI | InChI=1S/C4H13N3O7P2/c1-3(14-16(11,12)13-2)6-4(5)7-15(8,9)10/h3H,1-2H3,(H,11,12)(H5,5,6,7,8,9,10) |
| InChIKey | UCCGPNUASVTVII-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 163.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|