C7H11O4- — CID 21145100
(1S,3R,4S)-3,4-dihydroxycyclohexane-1-carboxylate (PubChem CID 21145100) has the molecular formula C7H11O4- and a molecular weight of 159.16 g/mol. Its IUPAC name is (1S,3R,4S)-3,4-dihydroxycyclohexane-1-carboxylate.
| Compound Name | (1S,3R,4S)-3,4-dihydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 21145100 |
| Molecular Formula | C7H11O4- |
| Molecular Weight | 159.16 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | (1S,3R,4S)-3,4-dihydroxycyclohexane-1-carboxylate |
| SMILES | O=C([O-])[C@H]1CC[C@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C7H12O4/c8-5-2-1-4(7(10)11)3-6(5)9/h4-6,8-9H,1-3H2,(H,10,11)/p-1/t4-,5-,6+/m0/s1 |
| InChIKey | PTPROPUVXIZJPL-HCWXCVPCSA-M |
| XLogP | -1.74 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.16 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |