About 1,6-dihydroxy-2-methylcyclohexa-2,4-diene-1-carboxylate
1,6-dihydroxy-2-methylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 21145165) has the molecular formula C8H9O4-
and a molecular weight of 169.16 g/mol. Its IUPAC name is 1,6-dihydroxy-2-methylcyclohexa-2,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | 1,6-dihydroxy-2-methylcyclohexa-2,4-diene-1-carboxylate |
| PubChem CID | 21145165 |
| Molecular Formula | C8H9O4- |
| Molecular Weight | 169.16 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | 1,6-dihydroxy-2-methylcyclohexa-2,4-diene-1-carboxylate |
| SMILES | CC1=CC=CC(O)C1(O)C(=O)[O-] |
| InChI | InChI=1S/C8H10O4/c1-5-3-2-4-6(9)8(5,12)7(10)11/h2-4,6,9,12H,1H3,(H,10,11)/p-1 |
| InChIKey | LHEBXDITPBTHSR-UHFFFAOYSA-M |
| XLogP | -1.66 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.16 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,6-dihydroxy-2-methylcyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dihydroxy-2-methylcyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of 1,6-dihydroxy-2-methylcyclohexa-2,4-diene-1-carboxylate (CID 21145165) is 1,6-dihydroxy-2-methylcyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for 1,6-dihydroxy-2-methylcyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for 1,6-dihydroxy-2-methylcyclohexa-2,4-diene-1-carboxylate is CC1=CC=CC(O)C1(O)C(=O)[O-].
What is the InChIKey of 1,6-dihydroxy-2-methylcyclohexa-2,4-diene-1-carboxylate?
The InChIKey is LHEBXDITPBTHSR-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H10O4/c1-5-3-2-4-6(9)8(5,12)7(10)11/h2-4,6,9,12H,1H3,(H,10,11)/p-1.
What are the key properties of 1,6-dihydroxy-2-methylcyclohexa-2,4-diene-1-carboxylate?
1,6-dihydroxy-2-methylcyclohexa-2,4-diene-1-carboxylate has a molecular weight of 169.16 g/mol, XLogP of -1.66, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dihydroxy-2-methylcyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 21145165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).