C26H24F2N2O4 — CID 21145877
benzyl N-[5-(benzylamino)-4,4-difluoro-3,5-dioxo-1-phenylpentan-2-yl]carbamate (PubChem CID 21145877) has the molecular formula C26H24F2N2O4 and a molecular weight of 466.48 g/mol. Its IUPAC name is benzyl N-[5-(benzylamino)-4,4-difluoro-3,5-dioxo-1-phenylpentan-2-yl]carbamate.
| Compound Name | benzyl N-[5-(benzylamino)-4,4-difluoro-3,5-dioxo-1-phenylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 21145877 |
| Molecular Formula | C26H24F2N2O4 |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | benzyl N-[5-(benzylamino)-4,4-difluoro-3,5-dioxo-1-phenylpentan-2-yl]carbamate |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)C(F)(F)C(=O)NCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C26H24F2N2O4/c27-26(28,24(32)29-17-20-12-6-2-7-13-20)23(31)22(16-19-10-4-1-5-11-19)30-25(33)34-18-21-14-8-3-9-15-21/h1-15,22H,16-18H2,(H,29,32)(H,30,33) |
| InChIKey | DVZYXCFGZKASRG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|