C21H28N2O — CID 21146126
(1R,15R,17S,18S)-17-ethyl-7-methoxy-3-methyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene (PubChem CID 21146126) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is (1R,15R,17S,18S)-17-ethyl-7-methoxy-3-methyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene.
| Compound Name | (1R,15R,17S,18S)-17-ethyl-7-methoxy-3-methyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene |
|---|---|
| PubChem CID | 21146126 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | (1R,15R,17S,18S)-17-ethyl-7-methoxy-3-methyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene |
| SMILES | CC[C@H]1C[C@@H]2C[C@H]3c4c(c5cc(OC)ccc5n4C)CCN(C2)[C@@H]13 |
| InChI | InChI=1S/C21H28N2O/c1-4-14-9-13-10-18-20(14)23(12-13)8-7-16-17-11-15(24-3)5-6-19(17)22(2)21(16)18/h5-6,11,13-14,18,20H,4,7-10,12H2,1-3H3/t13-,14+,18-,20+/m1/s1 |
| InChIKey | GZIPIZQXYGKJCX-MKKLKVPQSA-N |
| XLogP | 3.95 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |