About butane;N-(diethylaminodisulfanyl)-N-ethylethanamine;hydrochloride
butane;N-(diethylaminodisulfanyl)-N-ethylethanamine;hydrochloride (PubChem CID 21146152) has the molecular formula C12H31ClN2S2
and a molecular weight of 302.98 g/mol. Its IUPAC name is butane;N-(diethylaminodisulfanyl)-N-ethylethanamine;hydrochloride.
Molecular Properties
| Compound Name | butane;N-(diethylaminodisulfanyl)-N-ethylethanamine;hydrochloride |
| PubChem CID | 21146152 |
| Molecular Formula | C12H31ClN2S2 |
| Molecular Weight | 302.98 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | butane;N-(diethylaminodisulfanyl)-N-ethylethanamine;hydrochloride |
| SMILES | CCCC.CCN(CC)SSN(CC)CC.Cl |
| InChI | InChI=1S/C8H20N2S2.C4H10.ClH/c1-5-9(6-2)11-12-10(7-3)8-4;1-3-4-2;/h5-8H2,1-4H3;3-4H2,1-2H3;1H |
| InChIKey | SPEBSAVOSPZXSM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.98 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze butane;N-(diethylaminodisulfanyl)-N-ethylethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;N-(diethylaminodisulfanyl)-N-ethylethanamine;hydrochloride?
The IUPAC name of butane;N-(diethylaminodisulfanyl)-N-ethylethanamine;hydrochloride (CID 21146152) is butane;N-(diethylaminodisulfanyl)-N-ethylethanamine;hydrochloride.
What is the SMILES notation for butane;N-(diethylaminodisulfanyl)-N-ethylethanamine;hydrochloride?
The canonical SMILES for butane;N-(diethylaminodisulfanyl)-N-ethylethanamine;hydrochloride is CCCC.CCN(CC)SSN(CC)CC.Cl.
What is the InChIKey of butane;N-(diethylaminodisulfanyl)-N-ethylethanamine;hydrochloride?
The InChIKey is SPEBSAVOSPZXSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N2S2.C4H10.ClH/c1-5-9(6-2)11-12-10(7-3)8-4;1-3-4-2;/h5-8H2,1-4H3;3-4H2,1-2H3;1H.
What are the key properties of butane;N-(diethylaminodisulfanyl)-N-ethylethanamine;hydrochloride?
butane;N-(diethylaminodisulfanyl)-N-ethylethanamine;hydrochloride has a molecular weight of 302.98 g/mol, XLogP of 5.11, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butane;N-(diethylaminodisulfanyl)-N-ethylethanamine;hydrochloride is sourced from PubChem (CID 21146152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).