C30H37N3O5 — CID 21146302
tert-butyl N-[5-[(4-amino-3-hydroxybenzoyl)amino]-4-hydroxy-1,6-diphenylhexan-2-yl]carbamate (PubChem CID 21146302) has the molecular formula C30H37N3O5 and a molecular weight of 519.64 g/mol. Its IUPAC name is tert-butyl N-[5-[(4-amino-3-hydroxybenzoyl)amino]-4-hydroxy-1,6-diphenylhexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-[(4-amino-3-hydroxybenzoyl)amino]-4-hydroxy-1,6-diphenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 21146302 |
| Molecular Formula | C30H37N3O5 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | tert-butyl N-[5-[(4-amino-3-hydroxybenzoyl)amino]-4-hydroxy-1,6-diphenylhexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)CC(O)C(Cc1ccccc1)NC(=O)c1ccc(N)c(O)c1 |
| InChI | InChI=1S/C30H37N3O5/c1-30(2,3)38-29(37)32-23(16-20-10-6-4-7-11-20)19-27(35)25(17-21-12-8-5-9-13-21)33-28(36)22-14-15-24(31)26(34)18-22/h4-15,18,23,25,27,34-35H,16-17,19,31H2,1-3H3,(H,32,37)(H,33,36) |
| InChIKey | YZLFNZBHOOWAEL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|