About 1,3-dimethyl-2,5-dihydropteridine
1,3-dimethyl-2,5-dihydropteridine (PubChem CID 21146665) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is 1,3-dimethyl-2,5-dihydropteridine.
Molecular Properties
| Compound Name | 1,3-dimethyl-2,5-dihydropteridine |
| PubChem CID | 21146665 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 1,3-dimethyl-2,5-dihydropteridine |
| SMILES | CN1C=C2NC=CN=C2N(C)C1 |
| InChI | InChI=1S/C8H12N4/c1-11-5-7-8(12(2)6-11)10-4-3-9-7/h3-5,9H,6H2,1-2H3 |
| InChIKey | FDNIDYIPNVVRTJ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-dimethyl-2,5-dihydropteridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-2,5-dihydropteridine?
The IUPAC name of 1,3-dimethyl-2,5-dihydropteridine (CID 21146665) is 1,3-dimethyl-2,5-dihydropteridine.
What is the SMILES notation for 1,3-dimethyl-2,5-dihydropteridine?
The canonical SMILES for 1,3-dimethyl-2,5-dihydropteridine is CN1C=C2NC=CN=C2N(C)C1.
What is the InChIKey of 1,3-dimethyl-2,5-dihydropteridine?
The InChIKey is FDNIDYIPNVVRTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4/c1-11-5-7-8(12(2)6-11)10-4-3-9-7/h3-5,9H,6H2,1-2H3.
What are the key properties of 1,3-dimethyl-2,5-dihydropteridine?
1,3-dimethyl-2,5-dihydropteridine has a molecular weight of 164.21 g/mol, XLogP of 0.14, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-2,5-dihydropteridine is sourced from PubChem (CID 21146665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).