C25H28Br2N2O5S — CID 21146875
methyl 5-[(4S)-1,3-bis[(3-bromophenyl)methyl]-2,5,5-trioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-4-yl]pentanoate (PubChem CID 21146875) has the molecular formula C25H28Br2N2O5S and a molecular weight of 628.38 g/mol. Its IUPAC name is methyl 5-[(4S)-1,3-bis[(3-bromophenyl)methyl]-2,5,5-trioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-4-yl]pentanoate.
| Compound Name | methyl 5-[(4S)-1,3-bis[(3-bromophenyl)methyl]-2,5,5-trioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
|---|---|
| PubChem CID | 21146875 |
| Molecular Formula | C25H28Br2N2O5S |
| Molecular Weight | 628.38 g/mol |
| Exact Mass | 626.01 |
| IUPAC Name | methyl 5-[(4S)-1,3-bis[(3-bromophenyl)methyl]-2,5,5-trioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
| SMILES | COC(=O)CCCC[C@H]1C2C(CS1(=O)=O)N(Cc1cccc(Br)c1)C(=O)N2Cc1cccc(Br)c1 |
| InChI | InChI=1S/C25H28Br2N2O5S/c1-34-23(30)11-3-2-10-22-24-21(16-35(22,32)33)28(14-17-6-4-8-19(26)12-17)25(31)29(24)15-18-7-5-9-20(27)13-18/h4-9,12-13,21-22,24H,2-3,10-11,14-16H2,1H3/t21?,22-,24?/m0/s1 |
| InChIKey | FAJDYRCRPWTHCR-MHIUNMELSA-N |
| XLogP | 4.92 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.38 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|