C33H33BrN2O4 — CID 21146999
(4R,5R,6R)-4-benzyl-6-[(1S)-1-bromo-2-phenylethyl]-5-hydroxy-1,3-bis[(3-hydroxyphenyl)methyl]-1,3-diazinan-2-one (PubChem CID 21146999) has the molecular formula C33H33BrN2O4 and a molecular weight of 601.54 g/mol. Its IUPAC name is (4R,5R,6R)-4-benzyl-6-[(1S)-1-bromo-2-phenylethyl]-5-hydroxy-1,3-bis[(3-hydroxyphenyl)methyl]-1,3-diazinan-2-one.
| Compound Name | (4R,5R,6R)-4-benzyl-6-[(1S)-1-bromo-2-phenylethyl]-5-hydroxy-1,3-bis[(3-hydroxyphenyl)methyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 21146999 |
| Molecular Formula | C33H33BrN2O4 |
| Molecular Weight | 601.54 g/mol |
| Exact Mass | 600.16 |
| IUPAC Name | (4R,5R,6R)-4-benzyl-6-[(1S)-1-bromo-2-phenylethyl]-5-hydroxy-1,3-bis[(3-hydroxyphenyl)methyl]-1,3-diazinan-2-one |
| SMILES | O=C1N(Cc2cccc(O)c2)[C@@H]([C@@H](Br)Cc2ccccc2)[C@H](O)[C@@H](Cc2ccccc2)N1Cc1cccc(O)c1 |
| InChI | InChI=1S/C33H33BrN2O4/c34-29(19-23-9-3-1-4-10-23)31-32(39)30(20-24-11-5-2-6-12-24)35(21-25-13-7-15-27(37)17-25)33(40)36(31)22-26-14-8-16-28(38)18-26/h1-18,29-32,37-39H,19-22H2/t29-,30+,31-,32+/m0/s1 |
| InChIKey | SPIRPFZSFUSALD-MLMSKLGMSA-N |
| XLogP | 5.88 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.54 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|