C11H11Cl2N4S+ — CID 21147400
[4-(2,6-dichlorophenyl)-1,2,5-thiadiazol-3-yl]-methanimidoyl-dimethylazanium (PubChem CID 21147400) has the molecular formula C11H11Cl2N4S+ and a molecular weight of 302.21 g/mol. Its IUPAC name is [4-(2,6-dichlorophenyl)-1,2,5-thiadiazol-3-yl]-methanimidoyl-dimethylazanium.
| Compound Name | [4-(2,6-dichlorophenyl)-1,2,5-thiadiazol-3-yl]-methanimidoyl-dimethylazanium |
|---|---|
| PubChem CID | 21147400 |
| Molecular Formula | C11H11Cl2N4S+ |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | [4-(2,6-dichlorophenyl)-1,2,5-thiadiazol-3-yl]-methanimidoyl-dimethylazanium |
| SMILES | [H]/N=C/[N+](C)(C)c1nsnc1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H11Cl2N4S/c1-17(2,6-14)11-10(15-18-16-11)9-7(12)4-3-5-8(9)13/h3-6,14H,1-2H3/q+1/b14-6+ |
| InChIKey | ZKBQKKBWEWWTFG-MKMNVTDBSA-N |
| XLogP | 3.69 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|