About ethyl 4-[bis(2-phenylacetyl)amino]-3-thia-1-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene-5-carboxylate
ethyl 4-[bis(2-phenylacetyl)amino]-3-thia-1-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene-5-carboxylate (PubChem CID 21148358) has the molecular formula C28H28N2O4S
and a molecular weight of 488.61 g/mol. Its IUPAC name is ethyl 4-[bis(2-phenylacetyl)amino]-3-thia-1-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[bis(2-phenylacetyl)amino]-3-thia-1-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene-5-carboxylate |
| PubChem CID | 21148358 |
| Molecular Formula | C28H28N2O4S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | ethyl 4-[bis(2-phenylacetyl)amino]-3-thia-1-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene-5-carboxylate |
| SMILES | CCOC(=O)c1c(N(C(=O)Cc2ccccc2)C(=O)Cc2ccccc2)sc2c1C1CCN2CC1 |
| InChI | InChI=1S/C28H28N2O4S/c1-2-34-28(33)25-24-21-13-15-29(16-14-21)26(24)35-27(25)30(22(31)17-19-9-5-3-6-10-19)23(32)18-20-11-7-4-8-12-20/h3-12,21H,2,13-18H2,1H3 |
| InChIKey | FTFKPPFFWXJSOO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-[bis(2-phenylacetyl)amino]-3-thia-1-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[bis(2-phenylacetyl)amino]-3-thia-1-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene-5-carboxylate?
The IUPAC name of ethyl 4-[bis(2-phenylacetyl)amino]-3-thia-1-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene-5-carboxylate (CID 21148358) is ethyl 4-[bis(2-phenylacetyl)amino]-3-thia-1-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene-5-carboxylate.
What is the SMILES notation for ethyl 4-[bis(2-phenylacetyl)amino]-3-thia-1-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene-5-carboxylate?
The canonical SMILES for ethyl 4-[bis(2-phenylacetyl)amino]-3-thia-1-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene-5-carboxylate is CCOC(=O)c1c(N(C(=O)Cc2ccccc2)C(=O)Cc2ccccc2)sc2c1C1CCN2CC1.
What is the InChIKey of ethyl 4-[bis(2-phenylacetyl)amino]-3-thia-1-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene-5-carboxylate?
The InChIKey is FTFKPPFFWXJSOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28N2O4S/c1-2-34-28(33)25-24-21-13-15-29(16-14-21)26(24)35-27(25)30(22(31)17-19-9-5-3-6-10-19)23(32)18-20-11-7-4-8-12-20/h3-12,21H,2,13-18H2,1H3.
What are the key properties of ethyl 4-[bis(2-phenylacetyl)amino]-3-thia-1-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene-5-carboxylate?
ethyl 4-[bis(2-phenylacetyl)amino]-3-thia-1-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene-5-carboxylate has a molecular weight of 488.61 g/mol, XLogP of 4.97, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[bis(2-phenylacetyl)amino]-3-thia-1-azatricyclo[5.2.2.02,6]undeca-2(6),4-diene-5-carboxylate is sourced from PubChem (CID 21148358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).