About N"-(5-methoxy-4,6-dimethylpyrimidin-2-yl)-N'-(2-phenylethyl)methanetriamine
N"-(5-methoxy-4,6-dimethylpyrimidin-2-yl)-N'-(2-phenylethyl)methanetriamine (PubChem CID 21149293) has the molecular formula C16H23N5O
and a molecular weight of 301.39 g/mol. Its IUPAC name is N"-(5-methoxy-4,6-dimethylpyrimidin-2-yl)-N'-(2-phenylethyl)methanetriamine.
Molecular Properties
| Compound Name | N"-(5-methoxy-4,6-dimethylpyrimidin-2-yl)-N'-(2-phenylethyl)methanetriamine |
| PubChem CID | 21149293 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | N"-(5-methoxy-4,6-dimethylpyrimidin-2-yl)-N'-(2-phenylethyl)methanetriamine |
| SMILES | COc1c(C)nc(NC(N)NCCc2ccccc2)nc1C |
| InChI | InChI=1S/C16H23N5O/c1-11-14(22-3)12(2)20-16(19-11)21-15(17)18-10-9-13-7-5-4-6-8-13/h4-8,15,18H,9-10,17H2,1-3H3,(H,19,20,21) |
| InChIKey | WLYJSLFLDDQJRT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N"-(5-methoxy-4,6-dimethylpyrimidin-2-yl)-N'-(2-phenylethyl)methanetriamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N"-(5-methoxy-4,6-dimethylpyrimidin-2-yl)-N'-(2-phenylethyl)methanetriamine?
The IUPAC name of N"-(5-methoxy-4,6-dimethylpyrimidin-2-yl)-N'-(2-phenylethyl)methanetriamine (CID 21149293) is N"-(5-methoxy-4,6-dimethylpyrimidin-2-yl)-N'-(2-phenylethyl)methanetriamine.
What is the SMILES notation for N"-(5-methoxy-4,6-dimethylpyrimidin-2-yl)-N'-(2-phenylethyl)methanetriamine?
The canonical SMILES for N"-(5-methoxy-4,6-dimethylpyrimidin-2-yl)-N'-(2-phenylethyl)methanetriamine is COc1c(C)nc(NC(N)NCCc2ccccc2)nc1C.
What is the InChIKey of N"-(5-methoxy-4,6-dimethylpyrimidin-2-yl)-N'-(2-phenylethyl)methanetriamine?
The InChIKey is WLYJSLFLDDQJRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N5O/c1-11-14(22-3)12(2)20-16(19-11)21-15(17)18-10-9-13-7-5-4-6-8-13/h4-8,15,18H,9-10,17H2,1-3H3,(H,19,20,21).
What are the key properties of N"-(5-methoxy-4,6-dimethylpyrimidin-2-yl)-N'-(2-phenylethyl)methanetriamine?
N"-(5-methoxy-4,6-dimethylpyrimidin-2-yl)-N'-(2-phenylethyl)methanetriamine has a molecular weight of 301.39 g/mol, XLogP of 1.59, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N"-(5-methoxy-4,6-dimethylpyrimidin-2-yl)-N'-(2-phenylethyl)methanetriamine is sourced from PubChem (CID 21149293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).