About (1-butylpyrrolidin-3-yl) 9H-xanthene-9-carboxylate;hydrochloride
(1-butylpyrrolidin-3-yl) 9H-xanthene-9-carboxylate;hydrochloride (PubChem CID 21149950) has the molecular formula C22H26ClNO3
and a molecular weight of 387.91 g/mol. Its IUPAC name is (1-butylpyrrolidin-3-yl) 9H-xanthene-9-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | (1-butylpyrrolidin-3-yl) 9H-xanthene-9-carboxylate;hydrochloride |
| PubChem CID | 21149950 |
| Molecular Formula | C22H26ClNO3 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | (1-butylpyrrolidin-3-yl) 9H-xanthene-9-carboxylate;hydrochloride |
| SMILES | CCCCN1CCC(OC(=O)C2c3ccccc3Oc3ccccc32)C1.Cl |
| InChI | InChI=1S/C22H25NO3.ClH/c1-2-3-13-23-14-12-16(15-23)25-22(24)21-17-8-4-6-10-19(17)26-20-11-7-5-9-18(20)21;/h4-11,16,21H,2-3,12-15H2,1H3;1H |
| InChIKey | WNYFBLOCFIINJS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-butylpyrrolidin-3-yl) 9H-xanthene-9-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-butylpyrrolidin-3-yl) 9H-xanthene-9-carboxylate;hydrochloride?
The IUPAC name of (1-butylpyrrolidin-3-yl) 9H-xanthene-9-carboxylate;hydrochloride (CID 21149950) is (1-butylpyrrolidin-3-yl) 9H-xanthene-9-carboxylate;hydrochloride.
What is the SMILES notation for (1-butylpyrrolidin-3-yl) 9H-xanthene-9-carboxylate;hydrochloride?
The canonical SMILES for (1-butylpyrrolidin-3-yl) 9H-xanthene-9-carboxylate;hydrochloride is CCCCN1CCC(OC(=O)C2c3ccccc3Oc3ccccc32)C1.Cl.
What is the InChIKey of (1-butylpyrrolidin-3-yl) 9H-xanthene-9-carboxylate;hydrochloride?
The InChIKey is WNYFBLOCFIINJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25NO3.ClH/c1-2-3-13-23-14-12-16(15-23)25-22(24)21-17-8-4-6-10-19(17)26-20-11-7-5-9-18(20)21;/h4-11,16,21H,2-3,12-15H2,1H3;1H.
What are the key properties of (1-butylpyrrolidin-3-yl) 9H-xanthene-9-carboxylate;hydrochloride?
(1-butylpyrrolidin-3-yl) 9H-xanthene-9-carboxylate;hydrochloride has a molecular weight of 387.91 g/mol, XLogP of 4.76, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-butylpyrrolidin-3-yl) 9H-xanthene-9-carboxylate;hydrochloride is sourced from PubChem (CID 21149950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).