About 2-[(5-chloro-2,3-dihydro-1H-inden-2-yl)-methylamino]ethanol
2-[(5-chloro-2,3-dihydro-1H-inden-2-yl)-methylamino]ethanol (PubChem CID 21150325) has the molecular formula C12H16ClNO
and a molecular weight of 225.72 g/mol. Its IUPAC name is 2-[(5-chloro-2,3-dihydro-1H-inden-2-yl)-methylamino]ethanol.
Molecular Properties
| Compound Name | 2-[(5-chloro-2,3-dihydro-1H-inden-2-yl)-methylamino]ethanol |
| PubChem CID | 21150325 |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 2-[(5-chloro-2,3-dihydro-1H-inden-2-yl)-methylamino]ethanol |
| SMILES | CN(CCO)C1Cc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C12H16ClNO/c1-14(4-5-15)12-7-9-2-3-11(13)6-10(9)8-12/h2-3,6,12,15H,4-5,7-8H2,1H3 |
| InChIKey | IZCFYYZWEIDHPK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(5-chloro-2,3-dihydro-1H-inden-2-yl)-methylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-chloro-2,3-dihydro-1H-inden-2-yl)-methylamino]ethanol?
The IUPAC name of 2-[(5-chloro-2,3-dihydro-1H-inden-2-yl)-methylamino]ethanol (CID 21150325) is 2-[(5-chloro-2,3-dihydro-1H-inden-2-yl)-methylamino]ethanol.
What is the SMILES notation for 2-[(5-chloro-2,3-dihydro-1H-inden-2-yl)-methylamino]ethanol?
The canonical SMILES for 2-[(5-chloro-2,3-dihydro-1H-inden-2-yl)-methylamino]ethanol is CN(CCO)C1Cc2ccc(Cl)cc2C1.
What is the InChIKey of 2-[(5-chloro-2,3-dihydro-1H-inden-2-yl)-methylamino]ethanol?
The InChIKey is IZCFYYZWEIDHPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClNO/c1-14(4-5-15)12-7-9-2-3-11(13)6-10(9)8-12/h2-3,6,12,15H,4-5,7-8H2,1H3.
What are the key properties of 2-[(5-chloro-2,3-dihydro-1H-inden-2-yl)-methylamino]ethanol?
2-[(5-chloro-2,3-dihydro-1H-inden-2-yl)-methylamino]ethanol has a molecular weight of 225.72 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-chloro-2,3-dihydro-1H-inden-2-yl)-methylamino]ethanol is sourced from PubChem (CID 21150325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).