About calcium bis(4-oxohex-5-enoate)
calcium bis(4-oxohex-5-enoate) (PubChem CID 21150365) has the molecular formula C12H14CaO6
and a molecular weight of 294.32 g/mol. Its IUPAC name is calcium bis(4-oxohex-5-enoate).
Molecular Properties
| Compound Name | calcium bis(4-oxohex-5-enoate) |
| PubChem CID | 21150365 |
| Molecular Formula | C12H14CaO6 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | calcium bis(4-oxohex-5-enoate) |
| SMILES | C=CC(=O)CCC(=O)[O-].C=CC(=O)CCC(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C6H8O3.Ca/c2*1-2-5(7)3-4-6(8)9;/h2*2H,1,3-4H2,(H,8,9);/q;;+2/p-2 |
| InChIKey | AEJUKFIZDYITKE-UHFFFAOYSA-L |
| XLogP | -1.84 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze calcium bis(4-oxohex-5-enoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium bis(4-oxohex-5-enoate)?
The IUPAC name of calcium bis(4-oxohex-5-enoate) (CID 21150365) is calcium bis(4-oxohex-5-enoate).
What is the SMILES notation for calcium bis(4-oxohex-5-enoate)?
The canonical SMILES for calcium bis(4-oxohex-5-enoate) is C=CC(=O)CCC(=O)[O-].C=CC(=O)CCC(=O)[O-].[Ca+2].
What is the InChIKey of calcium bis(4-oxohex-5-enoate)?
The InChIKey is AEJUKFIZDYITKE-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H8O3.Ca/c2*1-2-5(7)3-4-6(8)9;/h2*2H,1,3-4H2,(H,8,9);/q;;+2/p-2.
What are the key properties of calcium bis(4-oxohex-5-enoate)?
calcium bis(4-oxohex-5-enoate) has a molecular weight of 294.32 g/mol, XLogP of -1.84, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for calcium bis(4-oxohex-5-enoate) is sourced from PubChem (CID 21150365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).