About 1-[4-[(E)-1,2-diphenyl-2-pyridin-2-ylethenyl]phenoxy]-N,N-diethylethanamine
1-[4-[(E)-1,2-diphenyl-2-pyridin-2-ylethenyl]phenoxy]-N,N-diethylethanamine (PubChem CID 21151196) has the molecular formula C31H32N2O
and a molecular weight of 448.61 g/mol. Its IUPAC name is 1-[4-[(E)-1,2-diphenyl-2-pyridin-2-ylethenyl]phenoxy]-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 1-[4-[(E)-1,2-diphenyl-2-pyridin-2-ylethenyl]phenoxy]-N,N-diethylethanamine |
| PubChem CID | 21151196 |
| Molecular Formula | C31H32N2O |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 1-[4-[(E)-1,2-diphenyl-2-pyridin-2-ylethenyl]phenoxy]-N,N-diethylethanamine |
| SMILES | CCN(CC)C(C)Oc1ccc(/C(=C(\c2ccccc2)c2ccccn2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H32N2O/c1-4-33(5-2)24(3)34-28-21-19-27(20-22-28)30(25-14-8-6-9-15-25)31(26-16-10-7-11-17-26)29-18-12-13-23-32-29/h6-24H,4-5H2,1-3H3/b31-30+ |
| InChIKey | UQCLHBHPMCIJAD-NVQSTNCTSA-N |
| XLogP | 7.16 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(E)-1,2-diphenyl-2-pyridin-2-ylethenyl]phenoxy]-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(E)-1,2-diphenyl-2-pyridin-2-ylethenyl]phenoxy]-N,N-diethylethanamine?
The IUPAC name of 1-[4-[(E)-1,2-diphenyl-2-pyridin-2-ylethenyl]phenoxy]-N,N-diethylethanamine (CID 21151196) is 1-[4-[(E)-1,2-diphenyl-2-pyridin-2-ylethenyl]phenoxy]-N,N-diethylethanamine.
What is the SMILES notation for 1-[4-[(E)-1,2-diphenyl-2-pyridin-2-ylethenyl]phenoxy]-N,N-diethylethanamine?
The canonical SMILES for 1-[4-[(E)-1,2-diphenyl-2-pyridin-2-ylethenyl]phenoxy]-N,N-diethylethanamine is CCN(CC)C(C)Oc1ccc(/C(=C(\c2ccccc2)c2ccccn2)c2ccccc2)cc1.
What is the InChIKey of 1-[4-[(E)-1,2-diphenyl-2-pyridin-2-ylethenyl]phenoxy]-N,N-diethylethanamine?
The InChIKey is UQCLHBHPMCIJAD-NVQSTNCTSA-N. The full InChI is InChI=1S/C31H32N2O/c1-4-33(5-2)24(3)34-28-21-19-27(20-22-28)30(25-14-8-6-9-15-25)31(26-16-10-7-11-17-26)29-18-12-13-23-32-29/h6-24H,4-5H2,1-3H3/b31-30+.
What are the key properties of 1-[4-[(E)-1,2-diphenyl-2-pyridin-2-ylethenyl]phenoxy]-N,N-diethylethanamine?
1-[4-[(E)-1,2-diphenyl-2-pyridin-2-ylethenyl]phenoxy]-N,N-diethylethanamine has a molecular weight of 448.61 g/mol, XLogP of 7.16, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(E)-1,2-diphenyl-2-pyridin-2-ylethenyl]phenoxy]-N,N-diethylethanamine is sourced from PubChem (CID 21151196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).