About S-benzamido ethanethioate
S-benzamido ethanethioate (PubChem CID 21151349) has the molecular formula C9H9NO2S
and a molecular weight of 195.24 g/mol. Its IUPAC name is S-benzamido ethanethioate.
Molecular Properties
| Compound Name | S-benzamido ethanethioate |
| PubChem CID | 21151349 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | S-benzamido ethanethioate |
| SMILES | CC(=O)SNC(=O)c1ccccc1 |
| InChI | InChI=1S/C9H9NO2S/c1-7(11)13-10-9(12)8-5-3-2-4-6-8/h2-6H,1H3,(H,10,12) |
| InChIKey | WWVMTTOXBCYVMT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-benzamido ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-benzamido ethanethioate?
The IUPAC name of S-benzamido ethanethioate (CID 21151349) is S-benzamido ethanethioate.
What is the SMILES notation for S-benzamido ethanethioate?
The canonical SMILES for S-benzamido ethanethioate is CC(=O)SNC(=O)c1ccccc1.
What is the InChIKey of S-benzamido ethanethioate?
The InChIKey is WWVMTTOXBCYVMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2S/c1-7(11)13-10-9(12)8-5-3-2-4-6-8/h2-6H,1H3,(H,10,12).
What are the key properties of S-benzamido ethanethioate?
S-benzamido ethanethioate has a molecular weight of 195.24 g/mol, XLogP of 1.61, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-benzamido ethanethioate is sourced from PubChem (CID 21151349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).