C44H43N5O7S2 — CID 21151524
4-[(1,8-dimethylquinolin-1-ium-4-yl)amino]-N-[4-[(1-methylpyridin-1-ium-4-yl)amino]phenyl]benzamide;bis(4-methylbenzenesulfonate) (PubChem CID 21151524) has the molecular formula C44H43N5O7S2 and a molecular weight of 817.99 g/mol. Its IUPAC name is 4-[(1,8-dimethylquinolin-1-ium-4-yl)amino]-N-[4-[(1-methylpyridin-1-ium-4-yl)amino]phenyl]benzamide;bis(4-methylbenzenesulfonate).
| Compound Name | 4-[(1,8-dimethylquinolin-1-ium-4-yl)amino]-N-[4-[(1-methylpyridin-1-ium-4-yl)amino]phenyl]benzamide;bis(4-methylbenzenesulfonate) |
|---|---|
| PubChem CID | 21151524 |
| Molecular Formula | C44H43N5O7S2 |
| Molecular Weight | 817.99 g/mol |
| Exact Mass | 817.26 |
| IUPAC Name | 4-[(1,8-dimethylquinolin-1-ium-4-yl)amino]-N-[4-[(1-methylpyridin-1-ium-4-yl)amino]phenyl]benzamide;bis(4-methylbenzenesulfonate) |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.Cc1ccc(S(=O)(=O)[O-])cc1.Cc1cccc2c(Nc3ccc(C(=O)Nc4ccc(Nc5cc[n+](C)cc5)cc4)cc3)cc[n+](C)c12 |
| InChI | InChI=1S/C30H27N5O.2C7H8O3S/c1-21-5-4-6-27-28(17-20-35(3)29(21)27)32-24-9-7-22(8-10-24)30(36)33-25-13-11-23(12-14-25)31-26-15-18-34(2)19-16-26;2*1-6-2-4-7(5-3-6)11(8,9)10/h4-20H,1-3H3,(H,33,36);2*2-5H,1H3,(H,8,9,10) |
| InChIKey | WYWWRCNCCRWKTB-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 175.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.99 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|