C10H15N3O2S — CID 21151748
8-butyl-6-methyl-8aH-[1,3,4]thiadiazolo[3,2-a]pyrimidine-5,7-dione (PubChem CID 21151748) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is 8-butyl-6-methyl-8aH-[1,3,4]thiadiazolo[3,2-a]pyrimidine-5,7-dione.
| Compound Name | 8-butyl-6-methyl-8aH-[1,3,4]thiadiazolo[3,2-a]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 21151748 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 8-butyl-6-methyl-8aH-[1,3,4]thiadiazolo[3,2-a]pyrimidine-5,7-dione |
| SMILES | CCCCN1C(=O)C(C)C(=O)N2N=CSC12 |
| InChI | InChI=1S/C10H15N3O2S/c1-3-4-5-12-8(14)7(2)9(15)13-10(12)16-6-11-13/h6-7,10H,3-5H2,1-2H3 |
| InChIKey | KPJLLIFGCIEPOM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|