About 6H-imidazo[4,5-g][1,3]benzothiazol-2-amine;hydrate;hydrochloride
6H-imidazo[4,5-g][1,3]benzothiazol-2-amine;hydrate;hydrochloride (PubChem CID 21151801) has the molecular formula C8H9ClN4OS
and a molecular weight of 244.71 g/mol. Its IUPAC name is 6H-imidazo[4,5-g][1,3]benzothiazol-2-amine;hydrate;hydrochloride.
Molecular Properties
| Compound Name | 6H-imidazo[4,5-g][1,3]benzothiazol-2-amine;hydrate;hydrochloride |
| PubChem CID | 21151801 |
| Molecular Formula | C8H9ClN4OS |
| Molecular Weight | 244.71 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 6H-imidazo[4,5-g][1,3]benzothiazol-2-amine;hydrate;hydrochloride |
| SMILES | Cl.Nc1nc2ccc3[nH]cnc3c2s1.O |
| InChI | InChI=1S/C8H6N4S.ClH.H2O/c9-8-12-5-2-1-4-6(7(5)13-8)11-3-10-4;;/h1-3H,(H2,9,12)(H,10,11);1H;1H2 |
| InChIKey | NMAVIKHXWBFWFA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 99.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.71 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6H-imidazo[4,5-g][1,3]benzothiazol-2-amine;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-imidazo[4,5-g][1,3]benzothiazol-2-amine;hydrate;hydrochloride?
The IUPAC name of 6H-imidazo[4,5-g][1,3]benzothiazol-2-amine;hydrate;hydrochloride (CID 21151801) is 6H-imidazo[4,5-g][1,3]benzothiazol-2-amine;hydrate;hydrochloride.
What is the SMILES notation for 6H-imidazo[4,5-g][1,3]benzothiazol-2-amine;hydrate;hydrochloride?
The canonical SMILES for 6H-imidazo[4,5-g][1,3]benzothiazol-2-amine;hydrate;hydrochloride is Cl.Nc1nc2ccc3[nH]cnc3c2s1.O.
What is the InChIKey of 6H-imidazo[4,5-g][1,3]benzothiazol-2-amine;hydrate;hydrochloride?
The InChIKey is NMAVIKHXWBFWFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N4S.ClH.H2O/c9-8-12-5-2-1-4-6(7(5)13-8)11-3-10-4;;/h1-3H,(H2,9,12)(H,10,11);1H;1H2.
What are the key properties of 6H-imidazo[4,5-g][1,3]benzothiazol-2-amine;hydrate;hydrochloride?
6H-imidazo[4,5-g][1,3]benzothiazol-2-amine;hydrate;hydrochloride has a molecular weight of 244.71 g/mol, XLogP of 1.35, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-imidazo[4,5-g][1,3]benzothiazol-2-amine;hydrate;hydrochloride is sourced from PubChem (CID 21151801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).