About (Z)-but-2-enedihydrazide;2-hydroxyethyl(trimethyl)azanium
(Z)-but-2-enedihydrazide;2-hydroxyethyl(trimethyl)azanium (PubChem CID 21152151) has the molecular formula C9H22N5O3+
and a molecular weight of 248.31 g/mol. Its IUPAC name is (Z)-but-2-enedihydrazide;2-hydroxyethyl(trimethyl)azanium.
Molecular Properties
| Compound Name | (Z)-but-2-enedihydrazide;2-hydroxyethyl(trimethyl)azanium |
| PubChem CID | 21152151 |
| Molecular Formula | C9H22N5O3+ |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | (Z)-but-2-enedihydrazide;2-hydroxyethyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)CCO.NNC(=O)/C=C\C(=O)NN |
| InChI | InChI=1S/C5H14NO.C4H8N4O2/c1-6(2,3)4-5-7;5-7-3(9)1-2-4(10)8-6/h7H,4-5H2,1-3H3;1-2H,5-6H2,(H,7,9)(H,8,10)/q+1;/b;2-1- |
| InChIKey | SDJQOFPGOKIGPN-BTJKTKAUSA-N |
| XLogP | -2.79 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedihydrazide;2-hydroxyethyl(trimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedihydrazide;2-hydroxyethyl(trimethyl)azanium?
The IUPAC name of (Z)-but-2-enedihydrazide;2-hydroxyethyl(trimethyl)azanium (CID 21152151) is (Z)-but-2-enedihydrazide;2-hydroxyethyl(trimethyl)azanium.
What is the SMILES notation for (Z)-but-2-enedihydrazide;2-hydroxyethyl(trimethyl)azanium?
The canonical SMILES for (Z)-but-2-enedihydrazide;2-hydroxyethyl(trimethyl)azanium is C[N+](C)(C)CCO.NNC(=O)/C=C\C(=O)NN.
What is the InChIKey of (Z)-but-2-enedihydrazide;2-hydroxyethyl(trimethyl)azanium?
The InChIKey is SDJQOFPGOKIGPN-BTJKTKAUSA-N. The full InChI is InChI=1S/C5H14NO.C4H8N4O2/c1-6(2,3)4-5-7;5-7-3(9)1-2-4(10)8-6/h7H,4-5H2,1-3H3;1-2H,5-6H2,(H,7,9)(H,8,10)/q+1;/b;2-1-.
What are the key properties of (Z)-but-2-enedihydrazide;2-hydroxyethyl(trimethyl)azanium?
(Z)-but-2-enedihydrazide;2-hydroxyethyl(trimethyl)azanium has a molecular weight of 248.31 g/mol, XLogP of -2.79, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedihydrazide;2-hydroxyethyl(trimethyl)azanium is sourced from PubChem (CID 21152151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).