C8H8N4S — CID 21152361
N-[(E)-cyclohexa-2,4-dien-1-ylideneamino]-1,3,4-thiadiazol-2-amine (PubChem CID 21152361) has the molecular formula C8H8N4S and a molecular weight of 192.25 g/mol. Its IUPAC name is N-[(E)-cyclohexa-2,4-dien-1-ylideneamino]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[(E)-cyclohexa-2,4-dien-1-ylideneamino]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 21152361 |
| Molecular Formula | C8H8N4S |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | N-[(E)-cyclohexa-2,4-dien-1-ylideneamino]-1,3,4-thiadiazol-2-amine |
| SMILES | C1=CC/C(=N\Nc2nncs2)C=C1 |
| InChI | InChI=1S/C8H8N4S/c1-2-4-7(5-3-1)10-12-8-11-9-6-13-8/h1-4,6H,5H2,(H,11,12)/b10-7- |
| InChIKey | XLMUFGVDMQPPSI-YFHOEESVSA-N |
| XLogP | 1.82 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|