C11H7Cl3N2O3 — CID 21152611
propanoic acid;2,4,5-trichloro-6-hydroxybenzene-1,3-dicarbonitrile (PubChem CID 21152611) has the molecular formula C11H7Cl3N2O3 and a molecular weight of 321.55 g/mol. Its IUPAC name is propanoic acid;2,4,5-trichloro-6-hydroxybenzene-1,3-dicarbonitrile.
| Compound Name | propanoic acid;2,4,5-trichloro-6-hydroxybenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 21152611 |
| Molecular Formula | C11H7Cl3N2O3 |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 319.95 |
| IUPAC Name | propanoic acid;2,4,5-trichloro-6-hydroxybenzene-1,3-dicarbonitrile |
| SMILES | CCC(=O)O.N#Cc1c(O)c(Cl)c(Cl)c(C#N)c1Cl |
| InChI | InChI=1S/C8HCl3N2O.C3H6O2/c9-5-3(1-12)6(10)7(11)8(14)4(5)2-13;1-2-3(4)5/h14H;2H2,1H3,(H,4,5) |
| InChIKey | YRLHEJBGHNPHAN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 105.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|