About N-[5-(4-chlorophenyl)-1,2,4-triazin-3-yl]propanehydrazide
N-[5-(4-chlorophenyl)-1,2,4-triazin-3-yl]propanehydrazide (PubChem CID 21152902) has the molecular formula C12H12ClN5O
and a molecular weight of 277.72 g/mol. Its IUPAC name is N-[5-(4-chlorophenyl)-1,2,4-triazin-3-yl]propanehydrazide.
Molecular Properties
| Compound Name | N-[5-(4-chlorophenyl)-1,2,4-triazin-3-yl]propanehydrazide |
| PubChem CID | 21152902 |
| Molecular Formula | C12H12ClN5O |
| Molecular Weight | 277.72 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-[5-(4-chlorophenyl)-1,2,4-triazin-3-yl]propanehydrazide |
| SMILES | CCC(=O)N(N)c1nncc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C12H12ClN5O/c1-2-11(19)18(14)12-16-10(7-15-17-12)8-3-5-9(13)6-4-8/h3-7H,2,14H2,1H3 |
| InChIKey | JIVYBUYDABYNEM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.72 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[5-(4-chlorophenyl)-1,2,4-triazin-3-yl]propanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(4-chlorophenyl)-1,2,4-triazin-3-yl]propanehydrazide?
The IUPAC name of N-[5-(4-chlorophenyl)-1,2,4-triazin-3-yl]propanehydrazide (CID 21152902) is N-[5-(4-chlorophenyl)-1,2,4-triazin-3-yl]propanehydrazide.
What is the SMILES notation for N-[5-(4-chlorophenyl)-1,2,4-triazin-3-yl]propanehydrazide?
The canonical SMILES for N-[5-(4-chlorophenyl)-1,2,4-triazin-3-yl]propanehydrazide is CCC(=O)N(N)c1nncc(-c2ccc(Cl)cc2)n1.
What is the InChIKey of N-[5-(4-chlorophenyl)-1,2,4-triazin-3-yl]propanehydrazide?
The InChIKey is JIVYBUYDABYNEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClN5O/c1-2-11(19)18(14)12-16-10(7-15-17-12)8-3-5-9(13)6-4-8/h3-7H,2,14H2,1H3.
What are the key properties of N-[5-(4-chlorophenyl)-1,2,4-triazin-3-yl]propanehydrazide?
N-[5-(4-chlorophenyl)-1,2,4-triazin-3-yl]propanehydrazide has a molecular weight of 277.72 g/mol, XLogP of 1.81, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(4-chlorophenyl)-1,2,4-triazin-3-yl]propanehydrazide is sourced from PubChem (CID 21152902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).