C14H26Cl2N2O — CID 21153102
1,1-dideuterio-2-(4-piperidin-1-ylphenyl)propan-1-amine;hydrate;dihydrochloride (PubChem CID 21153102) has the molecular formula C14H26Cl2N2O and a molecular weight of 311.29 g/mol. Its IUPAC name is 1,1-dideuterio-2-(4-piperidin-1-ylphenyl)propan-1-amine;hydrate;dihydrochloride.
| Compound Name | 1,1-dideuterio-2-(4-piperidin-1-ylphenyl)propan-1-amine;hydrate;dihydrochloride |
|---|---|
| PubChem CID | 21153102 |
| Molecular Formula | C14H26Cl2N2O |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 1,1-dideuterio-2-(4-piperidin-1-ylphenyl)propan-1-amine;hydrate;dihydrochloride |
| SMILES | Cl.Cl.O.[2H]C([2H])(N)C(C)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C14H22N2.2ClH.H2O/c1-12(11-15)13-5-7-14(8-6-13)16-9-3-2-4-10-16;;;/h5-8,12H,2-4,9-11,15H2,1H3;2*1H;1H2/i11D2;;; |
| InChIKey | ADSCOJHDIJWGJI-ZZOBSCKSSA-N |
| XLogP | 2.76 |
| TPSA | 60.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|