About bis(nonan-1-amine);sulfate
bis(nonan-1-amine);sulfate (PubChem CID 21153128) has the molecular formula C18H42N2O4S-2
and a molecular weight of 382.61 g/mol. Its IUPAC name is bis(nonan-1-amine);sulfate.
Molecular Properties
| Compound Name | bis(nonan-1-amine);sulfate |
| PubChem CID | 21153128 |
| Molecular Formula | C18H42N2O4S-2 |
| Molecular Weight | 382.61 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | bis(nonan-1-amine);sulfate |
| SMILES | CCCCCCCCCN.CCCCCCCCCN.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C9H21N.H2O4S/c2*1-2-3-4-5-6-7-8-9-10;1-5(2,3)4/h2*2-10H2,1H3;(H2,1,2,3,4)/p-2 |
| InChIKey | QUXPZHDHQJREMK-UHFFFAOYSA-L |
| XLogP | 4.05 |
| TPSA | 132.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.61 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze bis(nonan-1-amine);sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(nonan-1-amine);sulfate?
The IUPAC name of bis(nonan-1-amine);sulfate (CID 21153128) is bis(nonan-1-amine);sulfate.
What is the SMILES notation for bis(nonan-1-amine);sulfate?
The canonical SMILES for bis(nonan-1-amine);sulfate is CCCCCCCCCN.CCCCCCCCCN.O=S(=O)([O-])[O-].
What is the InChIKey of bis(nonan-1-amine);sulfate?
The InChIKey is QUXPZHDHQJREMK-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H21N.H2O4S/c2*1-2-3-4-5-6-7-8-9-10;1-5(2,3)4/h2*2-10H2,1H3;(H2,1,2,3,4)/p-2.
What are the key properties of bis(nonan-1-amine);sulfate?
bis(nonan-1-amine);sulfate has a molecular weight of 382.61 g/mol, XLogP of 4.05, 14 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(nonan-1-amine);sulfate is sourced from PubChem (CID 21153128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).