C21H18N2O3S2 — CID 2115313
N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-4-phenylsulfanylbutanamide (PubChem CID 2115313) has the molecular formula C21H18N2O3S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-4-phenylsulfanylbutanamide.
| Compound Name | N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-4-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 2115313 |
| Molecular Formula | C21H18N2O3S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-4-phenylsulfanylbutanamide |
| SMILES | O=C(CCCSc1ccccc1)Nc1nc(-c2ccco2)c(-c2ccco2)s1 |
| InChI | InChI=1S/C21H18N2O3S2/c24-18(11-6-14-27-15-7-2-1-3-8-15)22-21-23-19(16-9-4-12-25-16)20(28-21)17-10-5-13-26-17/h1-5,7-10,12-13H,6,11,14H2,(H,22,23,24) |
| InChIKey | COJVIAYNALTYEO-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|