About 2-methyl-1,2,3,4-tetrahydrocyclopenta[b]pyrrol-6-ol
2-methyl-1,2,3,4-tetrahydrocyclopenta[b]pyrrol-6-ol (PubChem CID 21153348) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is 2-methyl-1,2,3,4-tetrahydrocyclopenta[b]pyrrol-6-ol.
Analyze 2-methyl-1,2,3,4-tetrahydrocyclopenta[b]pyrrol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,2,3,4-tetrahydrocyclopenta[b]pyrrol-6-ol?
The IUPAC name of 2-methyl-1,2,3,4-tetrahydrocyclopenta[b]pyrrol-6-ol (CID 21153348) is 2-methyl-1,2,3,4-tetrahydrocyclopenta[b]pyrrol-6-ol.
What is the SMILES notation for 2-methyl-1,2,3,4-tetrahydrocyclopenta[b]pyrrol-6-ol?
The canonical SMILES for 2-methyl-1,2,3,4-tetrahydrocyclopenta[b]pyrrol-6-ol is CC1CC2=C(N1)C(O)=CC2.
What is the InChIKey of 2-methyl-1,2,3,4-tetrahydrocyclopenta[b]pyrrol-6-ol?
The InChIKey is LEBCVVHSCMRBSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO/c1-5-4-6-2-3-7(10)8(6)9-5/h3,5,9-10H,2,4H2,1H3.
What are the key properties of 2-methyl-1,2,3,4-tetrahydrocyclopenta[b]pyrrol-6-ol?
2-methyl-1,2,3,4-tetrahydrocyclopenta[b]pyrrol-6-ol has a molecular weight of 137.18 g/mol, XLogP of 1.47, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,2,3,4-tetrahydrocyclopenta[b]pyrrol-6-ol is sourced from PubChem (CID 21153348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).